C15H21F2N3O2 — CID 119430545
3-acetamido-3-(2,4-difluorophenyl)-N-[3-(methylamino)propyl]propanamide (PubChem CID 119430545) has the molecular formula C15H21F2N3O2 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-acetamido-3-(2,4-difluorophenyl)-N-[3-(methylamino)propyl]propanamide.
| Compound Name | 3-acetamido-3-(2,4-difluorophenyl)-N-[3-(methylamino)propyl]propanamide |
|---|---|
| PubChem CID | 119430545 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 3-acetamido-3-(2,4-difluorophenyl)-N-[3-(methylamino)propyl]propanamide |
| SMILES | CNCCCNC(=O)CC(NC(C)=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H21F2N3O2/c1-10(21)20-14(9-15(22)19-7-3-6-18-2)12-5-4-11(16)8-13(12)17/h4-5,8,14,18H,3,6-7,9H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | PCNHGBDDKQXCQU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|