C11H16N4O2 — CID 119431033
2-N-[3-(methylamino)propyl]pyridine-2,5-dicarboxamide (PubChem CID 119431033) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-N-[3-(methylamino)propyl]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-[3-(methylamino)propyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 119431033 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-N-[3-(methylamino)propyl]pyridine-2,5-dicarboxamide |
| SMILES | CNCCCNC(=O)c1ccc(C(N)=O)cn1 |
| InChI | InChI=1S/C11H16N4O2/c1-13-5-2-6-14-11(17)9-4-3-8(7-15-9)10(12)16/h3-4,7,13H,2,5-6H2,1H3,(H2,12,16)(H,14,17) |
| InChIKey | VWTNLWIEIOZMJM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|