C10H16BrCl2N3O — CID 119431575
5-bromo-N-[3-(methylamino)propyl]pyridine-2-carboxamide;dihydrochloride (PubChem CID 119431575) has the molecular formula C10H16BrCl2N3O and a molecular weight of 345.07 g/mol. Its IUPAC name is 5-bromo-N-[3-(methylamino)propyl]pyridine-2-carboxamide;dihydrochloride.
| Compound Name | 5-bromo-N-[3-(methylamino)propyl]pyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119431575 |
| Molecular Formula | C10H16BrCl2N3O |
| Molecular Weight | 345.07 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 5-bromo-N-[3-(methylamino)propyl]pyridine-2-carboxamide;dihydrochloride |
| SMILES | CNCCCNC(=O)c1ccc(Br)cn1.Cl.Cl |
| InChI | InChI=1S/C10H14BrN3O.2ClH/c1-12-5-2-6-13-10(15)9-4-3-8(11)7-14-9;;/h3-4,7,12H,2,5-6H2,1H3,(H,13,15);2*1H |
| InChIKey | YZTITOXHSIKXOF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.07 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|