C10H13BrN2O3 — CID 62958321
5-bromo-N-[2-(2-hydroxyethoxy)ethyl]pyridine-2-carboxamide (PubChem CID 62958321) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is 5-bromo-N-[2-(2-hydroxyethoxy)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(2-hydroxyethoxy)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62958321 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 5-bromo-N-[2-(2-hydroxyethoxy)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCOCCO)c1ccc(Br)cn1 |
| InChI | InChI=1S/C10H13BrN2O3/c11-8-1-2-9(13-7-8)10(15)12-3-5-16-6-4-14/h1-2,7,14H,3-6H2,(H,12,15) |
| InChIKey | NJBNEEBRZJCGDX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|