C9H12BrN3O3S — CID 55152309
5-bromo-N-[2-(methanesulfonamido)ethyl]pyridine-2-carboxamide (PubChem CID 55152309) has the molecular formula C9H12BrN3O3S and a molecular weight of 322.18 g/mol. Its IUPAC name is 5-bromo-N-[2-(methanesulfonamido)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(methanesulfonamido)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55152309 |
| Molecular Formula | C9H12BrN3O3S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 5-bromo-N-[2-(methanesulfonamido)ethyl]pyridine-2-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1ccc(Br)cn1 |
| InChI | InChI=1S/C9H12BrN3O3S/c1-17(15,16)13-5-4-11-9(14)8-3-2-7(10)6-12-8/h2-3,6,13H,4-5H2,1H3,(H,11,14) |
| InChIKey | GRBXDDZRYUPNQX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|