C16H20BrCl2N3OS — CID 119432163
2-[(5-bromo-2-pyridinyl)sulfanyl]-N-[3-(methylamino)propyl]benzamide;dihydrochloride (PubChem CID 119432163) has the molecular formula C16H20BrCl2N3OS and a molecular weight of 453.23 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-[3-(methylamino)propyl]benzamide;dihydrochloride.
| Compound Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-[3-(methylamino)propyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119432163 |
| Molecular Formula | C16H20BrCl2N3OS |
| Molecular Weight | 453.23 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-[3-(methylamino)propyl]benzamide;dihydrochloride |
| SMILES | CNCCCNC(=O)c1ccccc1Sc1ccc(Br)cn1.Cl.Cl |
| InChI | InChI=1S/C16H18BrN3OS.2ClH/c1-18-9-4-10-19-16(21)13-5-2-3-6-14(13)22-15-8-7-12(17)11-20-15;;/h2-3,5-8,11,18H,4,9-10H2,1H3,(H,19,21);2*1H |
| InChIKey | QPOZTVIZBPKWOA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|