C24H24BrN3O2S — CID 55966697
2-[(5-bromo-2-pyridinyl)sulfanyl]-N-(2-morpholin-4-yl-2-phenylethyl)benzamide (PubChem CID 55966697) has the molecular formula C24H24BrN3O2S and a molecular weight of 498.45 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-(2-morpholin-4-yl-2-phenylethyl)benzamide.
| Compound Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-(2-morpholin-4-yl-2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 55966697 |
| Molecular Formula | C24H24BrN3O2S |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-(2-morpholin-4-yl-2-phenylethyl)benzamide |
| SMILES | O=C(NCC(c1ccccc1)N1CCOCC1)c1ccccc1Sc1ccc(Br)cn1 |
| InChI | InChI=1S/C24H24BrN3O2S/c25-19-10-11-23(26-16-19)31-22-9-5-4-8-20(22)24(29)27-17-21(18-6-2-1-3-7-18)28-12-14-30-15-13-28/h1-11,16,21H,12-15,17H2,(H,27,29) |
| InChIKey | XRFKRLGWPJRPIF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |