C19H15BrN2O3S2 — CID 52659798
2-[(5-bromo-2-pyridinyl)sulfanyl]-N-(4-methylsulfonylphenyl)benzamide (PubChem CID 52659798) has the molecular formula C19H15BrN2O3S2 and a molecular weight of 463.38 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-(4-methylsulfonylphenyl)benzamide.
| Compound Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-(4-methylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 52659798 |
| Molecular Formula | C19H15BrN2O3S2 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)sulfanyl]-N-(4-methylsulfonylphenyl)benzamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2ccccc2Sc2ccc(Br)cn2)cc1 |
| InChI | InChI=1S/C19H15BrN2O3S2/c1-27(24,25)15-9-7-14(8-10-15)22-19(23)16-4-2-3-5-17(16)26-18-11-6-13(20)12-21-18/h2-12H,1H3,(H,22,23) |
| InChIKey | WVEMZYACGBFMNS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |