C16H17Cl2N3O2 — CID 119431195
6-(2,3-dichlorophenoxy)-N-[3-(methylamino)propyl]pyridine-3-carboxamide (PubChem CID 119431195) has the molecular formula C16H17Cl2N3O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is 6-(2,3-dichlorophenoxy)-N-[3-(methylamino)propyl]pyridine-3-carboxamide.
| Compound Name | 6-(2,3-dichlorophenoxy)-N-[3-(methylamino)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119431195 |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 6-(2,3-dichlorophenoxy)-N-[3-(methylamino)propyl]pyridine-3-carboxamide |
| SMILES | CNCCCNC(=O)c1ccc(Oc2cccc(Cl)c2Cl)nc1 |
| InChI | InChI=1S/C16H17Cl2N3O2/c1-19-8-3-9-20-16(22)11-6-7-14(21-10-11)23-13-5-2-4-12(17)15(13)18/h2,4-7,10,19H,3,8-9H2,1H3,(H,20,22) |
| InChIKey | IWPVQZULGMBSSK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|