C17H25Cl2N3O2S — CID 119432048
N-[3-(methylamino)propyl]-2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetamide;dihydrochloride (PubChem CID 119432048) has the molecular formula C17H25Cl2N3O2S and a molecular weight of 406.38 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetamide;dihydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119432048 |
| Molecular Formula | C17H25Cl2N3O2S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[3-(methylamino)propyl]-2-[2-[(4-methylphenoxy)methyl]-1,3-thiazol-4-yl]acetamide;dihydrochloride |
| SMILES | CNCCCNC(=O)Cc1csc(COc2ccc(C)cc2)n1.Cl.Cl |
| InChI | InChI=1S/C17H23N3O2S.2ClH/c1-13-4-6-15(7-5-13)22-11-17-20-14(12-23-17)10-16(21)19-9-3-8-18-2;;/h4-7,12,18H,3,8-11H2,1-2H3,(H,19,21);2*1H |
| InChIKey | OAZOKLKNFROVCI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|