C16H17N2O4S- — CID 9155391
2-[2-[2-[2-(4-methylphenoxy)ethylamino]-2-oxoethyl]-1,3-thiazol-4-yl]acetate (PubChem CID 9155391) has the molecular formula C16H17N2O4S- and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-methylphenoxy)ethylamino]-2-oxoethyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[2-[2-(4-methylphenoxy)ethylamino]-2-oxoethyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9155391 |
| Molecular Formula | C16H17N2O4S- |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[2-[2-[2-(4-methylphenoxy)ethylamino]-2-oxoethyl]-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1ccc(OCCNC(=O)Cc2nc(CC(=O)[O-])cs2)cc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-11-2-4-13(5-3-11)22-7-6-17-14(19)9-15-18-12(10-23-15)8-16(20)21/h2-5,10H,6-9H2,1H3,(H,17,19)(H,20,21)/p-1 |
| InChIKey | KYPJBWQPAVRQDV-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|