C22H21N2O4S- — CID 9155282
4-methyl-2-[2-[2-[4-(4-methylphenyl)phenoxy]ethylamino]-2-oxoethyl]-1,3-thiazole-5-carboxylate (PubChem CID 9155282) has the molecular formula C22H21N2O4S- and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-methyl-2-[2-[2-[4-(4-methylphenyl)phenoxy]ethylamino]-2-oxoethyl]-1,3-thiazole-5-carboxylate.
| Compound Name | 4-methyl-2-[2-[2-[4-(4-methylphenyl)phenoxy]ethylamino]-2-oxoethyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 9155282 |
| Molecular Formula | C22H21N2O4S- |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 4-methyl-2-[2-[2-[4-(4-methylphenyl)phenoxy]ethylamino]-2-oxoethyl]-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ccc(-c2ccc(OCCNC(=O)Cc3nc(C)c(C(=O)[O-])s3)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-14-3-5-16(6-4-14)17-7-9-18(10-8-17)28-12-11-23-19(25)13-20-24-15(2)21(29-20)22(26)27/h3-10H,11-13H2,1-2H3,(H,23,25)(H,26,27)/p-1 |
| InChIKey | XPNWCBNIPNMRNT-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|