C18H21N2O4S- — CID 9155148
4-methyl-2-[2-oxo-2-[2-(2,3,6-trimethylphenoxy)ethylamino]ethyl]-1,3-thiazole-5-carboxylate (PubChem CID 9155148) has the molecular formula C18H21N2O4S- and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-methyl-2-[2-oxo-2-[2-(2,3,6-trimethylphenoxy)ethylamino]ethyl]-1,3-thiazole-5-carboxylate.
| Compound Name | 4-methyl-2-[2-oxo-2-[2-(2,3,6-trimethylphenoxy)ethylamino]ethyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 9155148 |
| Molecular Formula | C18H21N2O4S- |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-methyl-2-[2-oxo-2-[2-(2,3,6-trimethylphenoxy)ethylamino]ethyl]-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ccc(C)c(OCCNC(=O)Cc2nc(C)c(C(=O)[O-])s2)c1C |
| InChI | InChI=1S/C18H22N2O4S/c1-10-5-6-11(2)16(12(10)3)24-8-7-19-14(21)9-15-20-13(4)17(25-15)18(22)23/h5-6H,7-9H2,1-4H3,(H,19,21)(H,22,23)/p-1 |
| InChIKey | WMLQRAYKUPKQRM-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|