C15H22ClN5O — CID 119432306
N-[3-(methylamino)propyl]-2-(5-methyl-1-phenyltriazol-4-yl)acetamide;hydrochloride (PubChem CID 119432306) has the molecular formula C15H22ClN5O and a molecular weight of 323.83 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-2-(5-methyl-1-phenyltriazol-4-yl)acetamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-2-(5-methyl-1-phenyltriazol-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119432306 |
| Molecular Formula | C15H22ClN5O |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-[3-(methylamino)propyl]-2-(5-methyl-1-phenyltriazol-4-yl)acetamide;hydrochloride |
| SMILES | CNCCCNC(=O)Cc1nnn(-c2ccccc2)c1C.Cl |
| InChI | InChI=1S/C15H21N5O.ClH/c1-12-14(11-15(21)17-10-6-9-16-2)18-19-20(12)13-7-4-3-5-8-13;/h3-5,7-8,16H,6,9-11H2,1-2H3,(H,17,21);1H |
| InChIKey | AXVDRKIKJYJKGT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|