C18H24N2O2 — CID 11943580
N-(1,3-benzodioxol-5-ylmethyl)-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine (PubChem CID 11943580) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine |
|---|---|
| PubChem CID | 11943580 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H24N2O2/c1-2-14-11-20-6-5-15(14)8-16(20)10-19-9-13-3-4-17-18(7-13)22-12-21-17/h2-4,7,14-16,19H,1,5-6,8-12H2/t14-,15-,16+/m0/s1 |
| InChIKey | OPCDCBPEDCHFNG-HRCADAONSA-N |
| XLogP | 2.40 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|