C14H21ClN4O4 — CID 119437225
1-[2-[2-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5-nitropyridin-2-one;hydrochloride (PubChem CID 119437225) has the molecular formula C14H21ClN4O4 and a molecular weight of 344.80 g/mol. Its IUPAC name is 1-[2-[2-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5-nitropyridin-2-one;hydrochloride.
| Compound Name | 1-[2-[2-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5-nitropyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119437225 |
| Molecular Formula | C14H21ClN4O4 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[2-[2-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5-nitropyridin-2-one;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)Cn1cc([N+](=O)[O-])ccc1=O.Cl |
| InChI | InChI=1S/C14H20N4O4.ClH/c1-10(15)12-4-2-3-7-17(12)14(20)9-16-8-11(18(21)22)5-6-13(16)19;/h5-6,8,10,12H,2-4,7,9,15H2,1H3;1H |
| InChIKey | ANHIDNDGHDILMF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|