C21H26FN3O2 — CID 119438130
N-[3-(ethylaminomethyl)phenyl]-2-(2-fluorophenyl)-2-morpholin-4-ylacetamide (PubChem CID 119438130) has the molecular formula C21H26FN3O2 and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[3-(ethylaminomethyl)phenyl]-2-(2-fluorophenyl)-2-morpholin-4-ylacetamide.
| Compound Name | N-[3-(ethylaminomethyl)phenyl]-2-(2-fluorophenyl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 119438130 |
| Molecular Formula | C21H26FN3O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[3-(ethylaminomethyl)phenyl]-2-(2-fluorophenyl)-2-morpholin-4-ylacetamide |
| SMILES | CCNCc1cccc(NC(=O)C(c2ccccc2F)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H26FN3O2/c1-2-23-15-16-6-5-7-17(14-16)24-21(26)20(25-10-12-27-13-11-25)18-8-3-4-9-19(18)22/h3-9,14,20,23H,2,10-13,15H2,1H3,(H,24,26) |
| InChIKey | SMINZAMIMSCDNV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |