C20H26FN3O3 — CID 71926685
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-(2-fluorophenyl)-2-morpholin-4-ylacetamide (PubChem CID 71926685) has the molecular formula C20H26FN3O3 and a molecular weight of 375.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-(2-fluorophenyl)-2-morpholin-4-ylacetamide.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-(2-fluorophenyl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 71926685 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-(2-fluorophenyl)-2-morpholin-4-ylacetamide |
| SMILES | CN(C)C(CNC(=O)C(c1ccccc1F)N1CCOCC1)c1ccco1 |
| InChI | InChI=1S/C20H26FN3O3/c1-23(2)17(18-8-5-11-27-18)14-22-20(25)19(24-9-12-26-13-10-24)15-6-3-4-7-16(15)21/h3-8,11,17,19H,9-10,12-14H2,1-2H3,(H,22,25) |
| InChIKey | AKLAWDCCXQKJJS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |