C17H20FN3O3 — CID 51162690
N-[2-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-2-oxoethyl]-2-fluorobenzamide (PubChem CID 51162690) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[2-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 51162690 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[2-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-2-oxoethyl]-2-fluorobenzamide |
| SMILES | CN(C)C(CNC(=O)CNC(=O)c1ccccc1F)c1ccco1 |
| InChI | InChI=1S/C17H20FN3O3/c1-21(2)14(15-8-5-9-24-15)10-19-16(22)11-20-17(23)12-6-3-4-7-13(12)18/h3-9,14H,10-11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | KUJNJUIQLVZCME-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |