C22H23FN2O3 — CID 55332202
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 55332202) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 55332202 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | CN(C)C(CNC(=O)c1ccccc1OCc1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C22H23FN2O3/c1-25(2)19(21-8-5-13-27-21)14-24-22(26)18-6-3-4-7-20(18)28-15-16-9-11-17(23)12-10-16/h3-13,19H,14-15H2,1-2H3,(H,24,26) |
| InChIKey | PDESJVVUOYQWHT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |