C22H27ClN4O2 — CID 119438563
N-[3-(ethylaminomethyl)phenyl]-1-phenyl-4-propoxypyrazole-3-carboxamide;hydrochloride (PubChem CID 119438563) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[3-(ethylaminomethyl)phenyl]-1-phenyl-4-propoxypyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(ethylaminomethyl)phenyl]-1-phenyl-4-propoxypyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119438563 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[3-(ethylaminomethyl)phenyl]-1-phenyl-4-propoxypyrazole-3-carboxamide;hydrochloride |
| SMILES | CCCOc1cn(-c2ccccc2)nc1C(=O)Nc1cccc(CNCC)c1.Cl |
| InChI | InChI=1S/C22H26N4O2.ClH/c1-3-13-28-20-16-26(19-11-6-5-7-12-19)25-21(20)22(27)24-18-10-8-9-17(14-18)15-23-4-2;/h5-12,14,16,23H,3-4,13,15H2,1-2H3,(H,24,27);1H |
| InChIKey | UIVQNCJZQGPQOG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |