C23H28N4O2 — CID 119440303
N-[2-(ethylaminomethyl)phenyl]-4-(2-methylpropoxy)-1-phenylpyrazole-3-carboxamide (PubChem CID 119440303) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-4-(2-methylpropoxy)-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-4-(2-methylpropoxy)-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119440303 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-4-(2-methylpropoxy)-1-phenylpyrazole-3-carboxamide |
| SMILES | CCNCc1ccccc1NC(=O)c1nn(-c2ccccc2)cc1OCC(C)C |
| InChI | InChI=1S/C23H28N4O2/c1-4-24-14-18-10-8-9-13-20(18)25-23(28)22-21(29-16-17(2)3)15-27(26-22)19-11-6-5-7-12-19/h5-13,15,17,24H,4,14,16H2,1-3H3,(H,25,28) |
| InChIKey | ICLFTOFKMCZKNH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |