C20H28N4O2 — CID 119604031
N-[2-(aminomethyl)cyclopentyl]-4-(2-methylpropoxy)-1-phenylpyrazole-3-carboxamide (PubChem CID 119604031) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-4-(2-methylpropoxy)-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-4-(2-methylpropoxy)-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119604031 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-4-(2-methylpropoxy)-1-phenylpyrazole-3-carboxamide |
| SMILES | CC(C)COc1cn(-c2ccccc2)nc1C(=O)NC1CCCC1CN |
| InChI | InChI=1S/C20H28N4O2/c1-14(2)13-26-18-12-24(16-8-4-3-5-9-16)23-19(18)20(25)22-17-10-6-7-15(17)11-21/h3-5,8-9,12,14-15,17H,6-7,10-11,13,21H2,1-2H3,(H,22,25) |
| InChIKey | XZKCCZRIVFXZJC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |