C19H27NO2 — CID 11943868
(5S,8S,10S,13R,14R)-5-amino-10,13-dimethyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 11943868) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (5S,8S,10S,13R,14R)-5-amino-10,13-dimethyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (5S,8S,10S,13R,14R)-5-amino-10,13-dimethyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 11943868 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (5S,8S,10S,13R,14R)-5-amino-10,13-dimethyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@@]12CC=C3[C@@H](CC[C@]4(N)CC(=O)CC[C@@]34C)[C@H]1CCC2=O |
| InChI | InChI=1S/C19H27NO2/c1-17-8-7-15-13(14(17)3-4-16(17)22)6-10-19(20)11-12(21)5-9-18(15,19)2/h7,13-14H,3-6,8-11,20H2,1-2H3/t13-,14+,17+,18-,19-/m0/s1 |
| InChIKey | VLBHITSZKGKLDU-MCRSOVSTSA-N |
| XLogP | 3.17 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|