C15H22Cl2N4O — CID 119439339
N-[2-(ethylaminomethyl)phenyl]-3-pyrazol-1-ylpropanamide;dihydrochloride (PubChem CID 119439339) has the molecular formula C15H22Cl2N4O and a molecular weight of 345.27 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-3-pyrazol-1-ylpropanamide;dihydrochloride.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-3-pyrazol-1-ylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119439339 |
| Molecular Formula | C15H22Cl2N4O |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-3-pyrazol-1-ylpropanamide;dihydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)CCn1cccn1.Cl.Cl |
| InChI | InChI=1S/C15H20N4O.2ClH/c1-2-16-12-13-6-3-4-7-14(13)18-15(20)8-11-19-10-5-9-17-19;;/h3-7,9-10,16H,2,8,11-12H2,1H3,(H,18,20);2*1H |
| InChIKey | ODCRLVGQVADNMU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |