C17H28N2O — CID 119440882
N-[2-(ethylaminomethyl)phenyl]-5,5-dimethylhexanamide (PubChem CID 119440882) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-5,5-dimethylhexanamide.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-5,5-dimethylhexanamide |
|---|---|
| PubChem CID | 119440882 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-5,5-dimethylhexanamide |
| SMILES | CCNCc1ccccc1NC(=O)CCCC(C)(C)C |
| InChI | InChI=1S/C17H28N2O/c1-5-18-13-14-9-6-7-10-15(14)19-16(20)11-8-12-17(2,3)4/h6-7,9-10,18H,5,8,11-13H2,1-4H3,(H,19,20) |
| InChIKey | UOGLHEVWOGXBGH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |