C22H26N3O2S+ — CID 11943972
(3S)-2-[2-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxamide (PubChem CID 11943972) has the molecular formula C22H26N3O2S+ and a molecular weight of 396.54 g/mol. Its IUPAC name is (3S)-2-[2-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxamide.
| Compound Name | (3S)-2-[2-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxamide |
|---|---|
| PubChem CID | 11943972 |
| Molecular Formula | C22H26N3O2S+ |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (3S)-2-[2-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxamide |
| SMILES | C[C@@H]1CCN(C(=O)C[NH+]2Cc3ccccc3C[C@H]2C(N)=O)c2ccccc2S1 |
| InChI | InChI=1S/C22H25N3O2S/c1-15-10-11-25(18-8-4-5-9-20(18)28-15)21(26)14-24-13-17-7-3-2-6-16(17)12-19(24)22(23)27/h2-9,15,19H,10-14H2,1H3,(H2,23,27)/p+1/t15-,19+/m1/s1 |
| InChIKey | FFDCLXTUKAFWLC-BEFAXECRSA-O |
| XLogP | 1.40 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |