C13H17N3OS2 — CID 36521926
[2-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] carbamimidothioate (PubChem CID 36521926) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is [2-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 36521926 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | [2-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)N1CC[C@@H](C)Sc2ccccc21 |
| InChI | InChI=1S/C13H17N3OS2/c1-9-6-7-16(12(17)8-18-13(14)15)10-4-2-3-5-11(10)19-9/h2-5,9H,6-8H2,1H3,(H3,14,15)/t9-/m1/s1 |
| InChIKey | WHFJLDFKPIMIQG-SECBINFHSA-N |
| XLogP | 2.53 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|