C18H22BrCl2N3O2 — CID 119441262
6-(4-bromophenoxy)-N-methyl-N-piperidin-4-ylpyridine-3-carboxamide;dihydrochloride (PubChem CID 119441262) has the molecular formula C18H22BrCl2N3O2 and a molecular weight of 463.20 g/mol. Its IUPAC name is 6-(4-bromophenoxy)-N-methyl-N-piperidin-4-ylpyridine-3-carboxamide;dihydrochloride.
| Compound Name | 6-(4-bromophenoxy)-N-methyl-N-piperidin-4-ylpyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119441262 |
| Molecular Formula | C18H22BrCl2N3O2 |
| Molecular Weight | 463.20 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 6-(4-bromophenoxy)-N-methyl-N-piperidin-4-ylpyridine-3-carboxamide;dihydrochloride |
| SMILES | CN(C(=O)c1ccc(Oc2ccc(Br)cc2)nc1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H20BrN3O2.2ClH/c1-22(15-8-10-20-11-9-15)18(23)13-2-7-17(21-12-13)24-16-5-3-14(19)4-6-16;;/h2-7,12,15,20H,8-11H2,1H3;2*1H |
| InChIKey | QQYUJYJJKNMMHD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |