C17H28N4O3 — CID 174638933
6-amino-N-methyl-N-piperidin-4-ylpyridine-3-carboxamide;tert-butyl formate (PubChem CID 174638933) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-amino-N-methyl-N-piperidin-4-ylpyridine-3-carboxamide;tert-butyl formate.
| Compound Name | 6-amino-N-methyl-N-piperidin-4-ylpyridine-3-carboxamide;tert-butyl formate |
|---|---|
| PubChem CID | 174638933 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 6-amino-N-methyl-N-piperidin-4-ylpyridine-3-carboxamide;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.CN(C(=O)c1ccc(N)nc1)C1CCNCC1 |
| InChI | InChI=1S/C12H18N4O.C5H10O2/c1-16(10-4-6-14-7-5-10)12(17)9-2-3-11(13)15-8-9;1-5(2,3)7-4-6/h2-3,8,10,14H,4-7H2,1H3,(H2,13,15);4H,1-3H3 |
| InChIKey | YIZNAPLPAHNNFJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|