C17H25ClN4O2 — CID 119442893
2-(3-ethyl-2-oxobenzimidazol-1-yl)-N-methyl-N-piperidin-4-ylacetamide;hydrochloride (PubChem CID 119442893) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 2-(3-ethyl-2-oxobenzimidazol-1-yl)-N-methyl-N-piperidin-4-ylacetamide;hydrochloride.
| Compound Name | 2-(3-ethyl-2-oxobenzimidazol-1-yl)-N-methyl-N-piperidin-4-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119442893 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-(3-ethyl-2-oxobenzimidazol-1-yl)-N-methyl-N-piperidin-4-ylacetamide;hydrochloride |
| SMILES | CCn1c(=O)n(CC(=O)N(C)C2CCNCC2)c2ccccc21.Cl |
| InChI | InChI=1S/C17H24N4O2.ClH/c1-3-20-14-6-4-5-7-15(14)21(17(20)23)12-16(22)19(2)13-8-10-18-11-9-13;/h4-7,13,18H,3,8-12H2,1-2H3;1H |
| InChIKey | RSYVLAJRRGBETK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |