C14H20Cl2N2OS — CID 119442906
2-(2-chlorophenyl)sulfanyl-N-methyl-N-piperidin-4-ylacetamide;hydrochloride (PubChem CID 119442906) has the molecular formula C14H20Cl2N2OS and a molecular weight of 335.30 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N-methyl-N-piperidin-4-ylacetamide;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N-methyl-N-piperidin-4-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119442906 |
| Molecular Formula | C14H20Cl2N2OS |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N-methyl-N-piperidin-4-ylacetamide;hydrochloride |
| SMILES | CN(C(=O)CSc1ccccc1Cl)C1CCNCC1.Cl |
| InChI | InChI=1S/C14H19ClN2OS.ClH/c1-17(11-6-8-16-9-7-11)14(18)10-19-13-5-3-2-4-12(13)15;/h2-5,11,16H,6-10H2,1H3;1H |
| InChIKey | LATVEMZRCCIKIU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |