C16H23FN2O — CID 119443185
3-(3-fluorophenyl)-N,2-dimethyl-N-piperidin-4-ylpropanamide (PubChem CID 119443185) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N,2-dimethyl-N-piperidin-4-ylpropanamide.
| Compound Name | 3-(3-fluorophenyl)-N,2-dimethyl-N-piperidin-4-ylpropanamide |
|---|---|
| PubChem CID | 119443185 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-(3-fluorophenyl)-N,2-dimethyl-N-piperidin-4-ylpropanamide |
| SMILES | CC(Cc1cccc(F)c1)C(=O)N(C)C1CCNCC1 |
| InChI | InChI=1S/C16H23FN2O/c1-12(10-13-4-3-5-14(17)11-13)16(20)19(2)15-6-8-18-9-7-15/h3-5,11-12,15,18H,6-10H2,1-2H3 |
| InChIKey | SSFGAUKYHBNKPW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |