C14H32Cl2N4OS — CID 119446260
2-[2-(diethylamino)ethylsulfanyl]-N-(2-piperazin-1-ylethyl)acetamide;dihydrochloride (PubChem CID 119446260) has the molecular formula C14H32Cl2N4OS and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfanyl]-N-(2-piperazin-1-ylethyl)acetamide;dihydrochloride.
| Compound Name | 2-[2-(diethylamino)ethylsulfanyl]-N-(2-piperazin-1-ylethyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119446260 |
| Molecular Formula | C14H32Cl2N4OS |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfanyl]-N-(2-piperazin-1-ylethyl)acetamide;dihydrochloride |
| SMILES | CCN(CC)CCSCC(=O)NCCN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H30N4OS.2ClH/c1-3-17(4-2)11-12-20-13-14(19)16-7-10-18-8-5-15-6-9-18;;/h15H,3-13H2,1-2H3,(H,16,19);2*1H |
| InChIKey | AFDHWEUBRJACRP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|