C14H28N4O2 — CID 108517977
N'-tert-butyl-N'-ethyl-N-(2-piperazin-1-ylethyl)oxamide (PubChem CID 108517977) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is N'-tert-butyl-N'-ethyl-N-(2-piperazin-1-ylethyl)oxamide.
| Compound Name | N'-tert-butyl-N'-ethyl-N-(2-piperazin-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517977 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | N'-tert-butyl-N'-ethyl-N-(2-piperazin-1-ylethyl)oxamide |
| SMILES | CCN(C(=O)C(=O)NCCN1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C14H28N4O2/c1-5-18(14(2,3)4)13(20)12(19)16-8-11-17-9-6-15-7-10-17/h15H,5-11H2,1-4H3,(H,16,19) |
| InChIKey | HBCRZTFKAUHWFT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|