C18H28N4O2 — CID 108503431
N'-benzyl-N-(2-piperazin-1-ylethyl)-N'-propan-2-yloxamide (PubChem CID 108503431) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N'-benzyl-N-(2-piperazin-1-ylethyl)-N'-propan-2-yloxamide.
| Compound Name | N'-benzyl-N-(2-piperazin-1-ylethyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 108503431 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N'-benzyl-N-(2-piperazin-1-ylethyl)-N'-propan-2-yloxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H28N4O2/c1-15(2)22(14-16-6-4-3-5-7-16)18(24)17(23)20-10-13-21-11-8-19-9-12-21/h3-7,15,19H,8-14H2,1-2H3,(H,20,23) |
| InChIKey | GFKGLPYSWVILBL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|