C16H23N3O3 — CID 108503523
N'-benzyl-N-(3-formamidopropyl)-N'-propan-2-yloxamide (PubChem CID 108503523) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is N'-benzyl-N-(3-formamidopropyl)-N'-propan-2-yloxamide.
| Compound Name | N'-benzyl-N-(3-formamidopropyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 108503523 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N'-benzyl-N-(3-formamidopropyl)-N'-propan-2-yloxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C(=O)NCCCNC=O |
| InChI | InChI=1S/C16H23N3O3/c1-13(2)19(11-14-7-4-3-5-8-14)16(22)15(21)18-10-6-9-17-12-20/h3-5,7-8,12-13H,6,9-11H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | BSRDACOINOJIOY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|