C12H24N4O3 — CID 108517854
N'-(1-hydroxybutan-2-yl)-N-(2-piperazin-1-ylethyl)oxamide (PubChem CID 108517854) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is N'-(1-hydroxybutan-2-yl)-N-(2-piperazin-1-ylethyl)oxamide.
| Compound Name | N'-(1-hydroxybutan-2-yl)-N-(2-piperazin-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517854 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | N'-(1-hydroxybutan-2-yl)-N-(2-piperazin-1-ylethyl)oxamide |
| SMILES | CCC(CO)NC(=O)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C12H24N4O3/c1-2-10(9-17)15-12(19)11(18)14-5-8-16-6-3-13-4-7-16/h10,13,17H,2-9H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | AHLNUEMIHPFQJJ-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|