C20H34N4O2 — CID 108509043
N'-[1-(1-adamantyl)ethyl]-N-(2-piperazin-1-ylethyl)oxamide (PubChem CID 108509043) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N'-[1-(1-adamantyl)ethyl]-N-(2-piperazin-1-ylethyl)oxamide.
| Compound Name | N'-[1-(1-adamantyl)ethyl]-N-(2-piperazin-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 108509043 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | N'-[1-(1-adamantyl)ethyl]-N-(2-piperazin-1-ylethyl)oxamide |
| SMILES | CC(NC(=O)C(=O)NCCN1CCNCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H34N4O2/c1-14(20-11-15-8-16(12-20)10-17(9-15)13-20)23-19(26)18(25)22-4-7-24-5-2-21-3-6-24/h14-17,21H,2-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | NXCKTXCFTWTIAF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|