C16H25Cl2N3O — CID 119446515
2-(2-chlorophenyl)-2-methyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride (PubChem CID 119446515) has the molecular formula C16H25Cl2N3O and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-methyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)-2-methyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119446515 |
| Molecular Formula | C16H25Cl2N3O |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-(2-chlorophenyl)-2-methyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride |
| SMILES | CC(C)(C(=O)NCCN1CCNCC1)c1ccccc1Cl.Cl |
| InChI | InChI=1S/C16H24ClN3O.ClH/c1-16(2,13-5-3-4-6-14(13)17)15(21)19-9-12-20-10-7-18-8-11-20;/h3-6,18H,7-12H2,1-2H3,(H,19,21);1H |
| InChIKey | MWYSDMBZJCRWSD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |