C19H29BrClN3O — CID 119447484
1-(3-bromophenyl)-N-(2-piperazin-1-ylethyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119447484) has the molecular formula C19H29BrClN3O and a molecular weight of 430.82 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(2-piperazin-1-ylethyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-(3-bromophenyl)-N-(2-piperazin-1-ylethyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119447484 |
| Molecular Formula | C19H29BrClN3O |
| Molecular Weight | 430.82 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 1-(3-bromophenyl)-N-(2-piperazin-1-ylethyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCNCC1)C1(c2cccc(Br)c2)CCCCC1 |
| InChI | InChI=1S/C19H28BrN3O.ClH/c20-17-6-4-5-16(15-17)19(7-2-1-3-8-19)18(24)22-11-14-23-12-9-21-10-13-23;/h4-6,15,21H,1-3,7-14H2,(H,22,24);1H |
| InChIKey | DBNMZCIQCJCMQD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |