C21H34ClN3O — CID 119393940
1-(3-methylphenyl)-N-(3-piperazin-1-ylpropyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119393940) has the molecular formula C21H34ClN3O and a molecular weight of 379.98 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-(3-piperazin-1-ylpropyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-(3-methylphenyl)-N-(3-piperazin-1-ylpropyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119393940 |
| Molecular Formula | C21H34ClN3O |
| Molecular Weight | 379.98 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-(3-methylphenyl)-N-(3-piperazin-1-ylpropyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cc1cccc(C2(C(=O)NCCCN3CCNCC3)CCCCC2)c1.Cl |
| InChI | InChI=1S/C21H33N3O.ClH/c1-18-7-5-8-19(17-18)21(9-3-2-4-10-21)20(25)23-11-6-14-24-15-12-22-13-16-24;/h5,7-8,17,22H,2-4,6,9-16H2,1H3,(H,23,25);1H |
| InChIKey | GHORRRSVXNHWFL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.98 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|