C21H32N2O — CID 119558765
1-(3-methylphenyl)-N-(2-piperidin-3-ylethyl)cyclohexane-1-carboxamide (PubChem CID 119558765) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-(2-piperidin-3-ylethyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(3-methylphenyl)-N-(2-piperidin-3-ylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119558765 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 1-(3-methylphenyl)-N-(2-piperidin-3-ylethyl)cyclohexane-1-carboxamide |
| SMILES | Cc1cccc(C2(C(=O)NCCC3CCCNC3)CCCCC2)c1 |
| InChI | InChI=1S/C21H32N2O/c1-17-7-5-9-19(15-17)21(11-3-2-4-12-21)20(24)23-14-10-18-8-6-13-22-16-18/h5,7,9,15,18,22H,2-4,6,8,10-14,16H2,1H3,(H,23,24) |
| InChIKey | ZMIMMNVPVVMCIC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |