C20H30N2OS — CID 119556086
1-(4-methylphenyl)sulfanyl-N-(2-piperidin-3-ylethyl)cyclopentane-1-carboxamide (PubChem CID 119556086) has the molecular formula C20H30N2OS and a molecular weight of 346.54 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfanyl-N-(2-piperidin-3-ylethyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfanyl-N-(2-piperidin-3-ylethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119556086 |
| Molecular Formula | C20H30N2OS |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-(4-methylphenyl)sulfanyl-N-(2-piperidin-3-ylethyl)cyclopentane-1-carboxamide |
| SMILES | Cc1ccc(SC2(C(=O)NCCC3CCCNC3)CCCC2)cc1 |
| InChI | InChI=1S/C20H30N2OS/c1-16-6-8-18(9-7-16)24-20(11-2-3-12-20)19(23)22-14-10-17-5-4-13-21-15-17/h6-9,17,21H,2-5,10-15H2,1H3,(H,22,23) |
| InChIKey | LRECHJUIKZIHOB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |