C18H25BrN2O — CID 119558146
1-(4-bromophenyl)-N-(2-piperidin-3-ylethyl)cyclobutane-1-carboxamide (PubChem CID 119558146) has the molecular formula C18H25BrN2O and a molecular weight of 365.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-(2-piperidin-3-ylethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-(2-piperidin-3-ylethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 119558146 |
| Molecular Formula | C18H25BrN2O |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-(4-bromophenyl)-N-(2-piperidin-3-ylethyl)cyclobutane-1-carboxamide |
| SMILES | O=C(NCCC1CCCNC1)C1(c2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C18H25BrN2O/c19-16-6-4-15(5-7-16)18(9-2-10-18)17(22)21-12-8-14-3-1-11-20-13-14/h4-7,14,20H,1-3,8-13H2,(H,21,22) |
| InChIKey | XXNTYJKWPWPZJL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |