C31H49NO4 — CID 11945045
bis[(1S,2R,3R,5S)-2,3-dimethyl-5-propan-2-ylcyclohexyl] 2,6-dimethylpyridine-3,5-dicarboxylate (PubChem CID 11945045) has the molecular formula C31H49NO4 and a molecular weight of 499.74 g/mol. Its IUPAC name is bis[(1S,2R,3R,5S)-2,3-dimethyl-5-propan-2-ylcyclohexyl] 2,6-dimethylpyridine-3,5-dicarboxylate.
| Compound Name | bis[(1S,2R,3R,5S)-2,3-dimethyl-5-propan-2-ylcyclohexyl] 2,6-dimethylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11945045 |
| Molecular Formula | C31H49NO4 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.37 |
| IUPAC Name | bis[(1S,2R,3R,5S)-2,3-dimethyl-5-propan-2-ylcyclohexyl] 2,6-dimethylpyridine-3,5-dicarboxylate |
| SMILES | Cc1nc(C)c(C(=O)O[C@H]2C[C@@H](C(C)C)C[C@@H](C)[C@H]2C)cc1C(=O)O[C@H]1C[C@@H](C(C)C)C[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C31H49NO4/c1-16(2)24-11-18(5)20(7)28(13-24)35-30(33)26-15-27(23(10)32-22(26)9)31(34)36-29-14-25(17(3)4)12-19(6)21(29)8/h15-21,24-25,28-29H,11-14H2,1-10H3/t18-,19-,20-,21-,24+,25+,28+,29+/m1/s1 |
| InChIKey | LPZFLVVVDYMPTQ-WYODPYQHSA-N |
| XLogP | 7.43 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |