C25H28O2 — CID 101186707
(2-methyl-5-propan-2-ylcyclohexyl) anthracene-9-carboxylate (PubChem CID 101186707) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2-methyl-5-propan-2-ylcyclohexyl) anthracene-9-carboxylate.
| Compound Name | (2-methyl-5-propan-2-ylcyclohexyl) anthracene-9-carboxylate |
|---|---|
| PubChem CID | 101186707 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (2-methyl-5-propan-2-ylcyclohexyl) anthracene-9-carboxylate |
| SMILES | CC(C)C1CCC(C)C(OC(=O)c2c3ccccc3cc3ccccc23)C1 |
| InChI | InChI=1S/C25H28O2/c1-16(2)18-13-12-17(3)23(15-18)27-25(26)24-21-10-6-4-8-19(21)14-20-9-5-7-11-22(20)24/h4-11,14,16-18,23H,12-13,15H2,1-3H3 |
| InChIKey | XIWFJPSFTNDLNT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|