C17H28Cl2N4O3S — CID 119451053
2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-pyrrolidin-3-ylacetamide;dihydrochloride (PubChem CID 119451053) has the molecular formula C17H28Cl2N4O3S and a molecular weight of 439.41 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-pyrrolidin-3-ylacetamide;dihydrochloride.
| Compound Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-pyrrolidin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119451053 |
| Molecular Formula | C17H28Cl2N4O3S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-pyrrolidin-3-ylacetamide;dihydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(=O)NC3CCNC3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C17H26N4O3S.2ClH/c1-14-2-4-16(5-3-14)25(23,24)21-10-8-20(9-11-21)13-17(22)19-15-6-7-18-12-15;;/h2-5,15,18H,6-13H2,1H3,(H,19,22);2*1H |
| InChIKey | BQFSKUWXMMRBNB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |