C14H16Cl2N2O — CID 119451122
2-(3,4-dichlorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide (PubChem CID 119451122) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119451122 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-pyrrolidin-3-ylcyclopropane-1-carboxamide |
| SMILES | O=C(NC1CCNC1)C1CC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O/c15-12-2-1-8(5-13(12)16)10-6-11(10)14(19)18-9-3-4-17-7-9/h1-2,5,9-11,17H,3-4,6-7H2,(H,18,19) |
| InChIKey | RVWLPGQRERBBCI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |