C19H22Cl2N4O — CID 119452060
2-methyl-1-phenyl-N-pyrrolidin-3-ylbenzimidazole-5-carboxamide;dihydrochloride (PubChem CID 119452060) has the molecular formula C19H22Cl2N4O and a molecular weight of 393.32 g/mol. Its IUPAC name is 2-methyl-1-phenyl-N-pyrrolidin-3-ylbenzimidazole-5-carboxamide;dihydrochloride.
| Compound Name | 2-methyl-1-phenyl-N-pyrrolidin-3-ylbenzimidazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119452060 |
| Molecular Formula | C19H22Cl2N4O |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-methyl-1-phenyl-N-pyrrolidin-3-ylbenzimidazole-5-carboxamide;dihydrochloride |
| SMILES | Cc1nc2cc(C(=O)NC3CCNC3)ccc2n1-c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H20N4O.2ClH/c1-13-21-17-11-14(19(24)22-15-9-10-20-12-15)7-8-18(17)23(13)16-5-3-2-4-6-16;;/h2-8,11,15,20H,9-10,12H2,1H3,(H,22,24);2*1H |
| InChIKey | UGEKWAZVKOPUSI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |